C26H31N5O8S — CID 98414328
5-[2-(2-methoxyethylsulfamoyl)-4-nitrophenoxy]-4-methyl-1-(4-methylphenyl)-N-[[(2R)-oxolan-2-yl]methyl]pyrazole-3-carboxamide (PubChem CID 98414328) has the molecular formula C26H31N5O8S and a molecular weight of 573.63 g/mol. Its IUPAC name is 5-[2-(2-methoxyethylsulfamoyl)-4-nitrophenoxy]-4-methyl-1-(4-methylphenyl)-N-[[(2R)-oxolan-2-yl]methyl]pyrazole-3-carboxamide.
| Compound Name | 5-[2-(2-methoxyethylsulfamoyl)-4-nitrophenoxy]-4-methyl-1-(4-methylphenyl)-N-[[(2R)-oxolan-2-yl]methyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 98414328 |
| Molecular Formula | C26H31N5O8S |
| Molecular Weight | 573.63 g/mol |
| Exact Mass | 573.19 |
| IUPAC Name | 5-[2-(2-methoxyethylsulfamoyl)-4-nitrophenoxy]-4-methyl-1-(4-methylphenyl)-N-[[(2R)-oxolan-2-yl]methyl]pyrazole-3-carboxamide |
| SMILES | COCCNS(=O)(=O)c1cc([N+](=O)[O-])ccc1Oc1c(C)c(C(=O)NC[C@H]2CCCO2)nn1-c1ccc(C)cc1 |
| InChI | InChI=1S/C26H31N5O8S/c1-17-6-8-19(9-7-17)30-26(18(2)24(29-30)25(32)27-16-21-5-4-13-38-21)39-22-11-10-20(31(33)34)15-23(22)40(35,36)28-12-14-37-3/h6-11,15,21,28H,4-5,12-14,16H2,1-3H3,(H,27,32)/t21-/m1/s1 |
| InChIKey | KHPBLLOECFUVNT-OAQYLSRUSA-N |
| XLogP | 3.02 |
| TPSA | 163.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.63 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|