C27H31N5O9S — CID 98444294
1-(4-methoxyphenyl)-4-methyl-5-(2-morpholin-4-ylsulfonyl-4-nitrophenoxy)-N-[[(2S)-oxolan-2-yl]methyl]pyrazole-3-carboxamide (PubChem CID 98444294) has the molecular formula C27H31N5O9S and a molecular weight of 601.64 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-4-methyl-5-(2-morpholin-4-ylsulfonyl-4-nitrophenoxy)-N-[[(2S)-oxolan-2-yl]methyl]pyrazole-3-carboxamide.
| Compound Name | 1-(4-methoxyphenyl)-4-methyl-5-(2-morpholin-4-ylsulfonyl-4-nitrophenoxy)-N-[[(2S)-oxolan-2-yl]methyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 98444294 |
| Molecular Formula | C27H31N5O9S |
| Molecular Weight | 601.64 g/mol |
| Exact Mass | 601.18 |
| IUPAC Name | 1-(4-methoxyphenyl)-4-methyl-5-(2-morpholin-4-ylsulfonyl-4-nitrophenoxy)-N-[[(2S)-oxolan-2-yl]methyl]pyrazole-3-carboxamide |
| SMILES | COc1ccc(-n2nc(C(=O)NC[C@@H]3CCCO3)c(C)c2Oc2ccc([N+](=O)[O-])cc2S(=O)(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C27H31N5O9S/c1-18-25(26(33)28-17-22-4-3-13-40-22)29-31(19-5-8-21(38-2)9-6-19)27(18)41-23-10-7-20(32(34)35)16-24(23)42(36,37)30-11-14-39-15-12-30/h5-10,16,22H,3-4,11-15,17H2,1-2H3,(H,28,33)/t22-/m0/s1 |
| InChIKey | UMQIVMAPHLLKHC-QFIPXVFZSA-N |
| XLogP | 2.82 |
| TPSA | 164.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.64 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|