C22H31N5O7S — CID 97473488
5-[2-[[(2R)-butan-2-yl]sulfamoyl]-4-nitrophenoxy]-1-ethyl-4-methyl-N-[[(2S)-oxolan-2-yl]methyl]pyrazole-3-carboxamide (PubChem CID 97473488) has the molecular formula C22H31N5O7S and a molecular weight of 509.59 g/mol. Its IUPAC name is 5-[2-[[(2R)-butan-2-yl]sulfamoyl]-4-nitrophenoxy]-1-ethyl-4-methyl-N-[[(2S)-oxolan-2-yl]methyl]pyrazole-3-carboxamide.
| Compound Name | 5-[2-[[(2R)-butan-2-yl]sulfamoyl]-4-nitrophenoxy]-1-ethyl-4-methyl-N-[[(2S)-oxolan-2-yl]methyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 97473488 |
| Molecular Formula | C22H31N5O7S |
| Molecular Weight | 509.59 g/mol |
| Exact Mass | 509.19 |
| IUPAC Name | 5-[2-[[(2R)-butan-2-yl]sulfamoyl]-4-nitrophenoxy]-1-ethyl-4-methyl-N-[[(2S)-oxolan-2-yl]methyl]pyrazole-3-carboxamide |
| SMILES | CC[C@@H](C)NS(=O)(=O)c1cc([N+](=O)[O-])ccc1Oc1c(C)c(C(=O)NC[C@@H]2CCCO2)nn1CC |
| InChI | InChI=1S/C22H31N5O7S/c1-5-14(3)25-35(31,32)19-12-16(27(29)30)9-10-18(19)34-22-15(4)20(24-26(22)6-2)21(28)23-13-17-8-7-11-33-17/h9-10,12,14,17,25H,5-8,11,13H2,1-4H3,(H,23,28)/t14-,17+/m1/s1 |
| InChIKey | LQSINPIUJUUODM-PBHICJAKSA-N |
| XLogP | 2.90 |
| TPSA | 154.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.59 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|