C22H31N5O6S — CID 97473392
5-[2-[[(2S)-butan-2-yl]sulfamoyl]-4-nitrophenoxy]-1-tert-butyl-N-cyclopropyl-4-methylpyrazole-3-carboxamide (PubChem CID 97473392) has the molecular formula C22H31N5O6S and a molecular weight of 493.59 g/mol. Its IUPAC name is 5-[2-[[(2S)-butan-2-yl]sulfamoyl]-4-nitrophenoxy]-1-tert-butyl-N-cyclopropyl-4-methylpyrazole-3-carboxamide.
| Compound Name | 5-[2-[[(2S)-butan-2-yl]sulfamoyl]-4-nitrophenoxy]-1-tert-butyl-N-cyclopropyl-4-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 97473392 |
| Molecular Formula | C22H31N5O6S |
| Molecular Weight | 493.59 g/mol |
| Exact Mass | 493.20 |
| IUPAC Name | 5-[2-[[(2S)-butan-2-yl]sulfamoyl]-4-nitrophenoxy]-1-tert-butyl-N-cyclopropyl-4-methylpyrazole-3-carboxamide |
| SMILES | CC[C@H](C)NS(=O)(=O)c1cc([N+](=O)[O-])ccc1Oc1c(C)c(C(=O)NC2CC2)nn1C(C)(C)C |
| InChI | InChI=1S/C22H31N5O6S/c1-7-13(2)25-34(31,32)18-12-16(27(29)30)10-11-17(18)33-21-14(3)19(20(28)23-15-8-9-15)24-26(21)22(4,5)6/h10-13,15,25H,7-9H2,1-6H3,(H,23,28)/t13-/m0/s1 |
| InChIKey | ZOTZSGIOCUQBRS-ZDUSSCGKSA-N |
| XLogP | 3.62 |
| TPSA | 145.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.59 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|