C22H29N5O6S — CID 71958986
1-tert-butyl-N-cyclopropyl-4-methyl-5-(4-nitro-2-pyrrolidin-1-ylsulfonylphenoxy)pyrazole-3-carboxamide (PubChem CID 71958986) has the molecular formula C22H29N5O6S and a molecular weight of 491.57 g/mol. Its IUPAC name is 1-tert-butyl-N-cyclopropyl-4-methyl-5-(4-nitro-2-pyrrolidin-1-ylsulfonylphenoxy)pyrazole-3-carboxamide.
| Compound Name | 1-tert-butyl-N-cyclopropyl-4-methyl-5-(4-nitro-2-pyrrolidin-1-ylsulfonylphenoxy)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 71958986 |
| Molecular Formula | C22H29N5O6S |
| Molecular Weight | 491.57 g/mol |
| Exact Mass | 491.18 |
| IUPAC Name | 1-tert-butyl-N-cyclopropyl-4-methyl-5-(4-nitro-2-pyrrolidin-1-ylsulfonylphenoxy)pyrazole-3-carboxamide |
| SMILES | Cc1c(C(=O)NC2CC2)nn(C(C)(C)C)c1Oc1ccc([N+](=O)[O-])cc1S(=O)(=O)N1CCCC1 |
| InChI | InChI=1S/C22H29N5O6S/c1-14-19(20(28)23-15-7-8-15)24-26(22(2,3)4)21(14)33-17-10-9-16(27(29)30)13-18(17)34(31,32)25-11-5-6-12-25/h9-10,13,15H,5-8,11-12H2,1-4H3,(H,23,28) |
| InChIKey | KKBAIKAFGQWRCV-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 136.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.57 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|