C23H31N5O8S — CID 83286080
[1-tert-butyl-4-methyl-5-(2-morpholin-4-ylsulfonyl-4-nitrophenoxy)pyrazol-3-yl]-morpholin-4-ylmethanone (PubChem CID 83286080) has the molecular formula C23H31N5O8S and a molecular weight of 537.60 g/mol. Its IUPAC name is [1-tert-butyl-4-methyl-5-(2-morpholin-4-ylsulfonyl-4-nitrophenoxy)pyrazol-3-yl]-morpholin-4-ylmethanone.
| Compound Name | [1-tert-butyl-4-methyl-5-(2-morpholin-4-ylsulfonyl-4-nitrophenoxy)pyrazol-3-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 83286080 |
| Molecular Formula | C23H31N5O8S |
| Molecular Weight | 537.60 g/mol |
| Exact Mass | 537.19 |
| IUPAC Name | [1-tert-butyl-4-methyl-5-(2-morpholin-4-ylsulfonyl-4-nitrophenoxy)pyrazol-3-yl]-morpholin-4-ylmethanone |
| SMILES | Cc1c(C(=O)N2CCOCC2)nn(C(C)(C)C)c1Oc1ccc([N+](=O)[O-])cc1S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C23H31N5O8S/c1-16-20(21(29)25-7-11-34-12-8-25)24-27(23(2,3)4)22(16)36-18-6-5-17(28(30)31)15-19(18)37(32,33)26-9-13-35-14-10-26/h5-6,15H,7-14H2,1-4H3 |
| InChIKey | SYXVKAFPGBSBNH-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 146.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.60 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|