C27H30F3N5O7S — CID 83272547
1-tert-butyl-4-methyl-5-(2-morpholin-4-ylsulfonyl-4-nitrophenoxy)-N-[[3-(trifluoromethyl)phenyl]methyl]pyrazole-3-carboxamide (PubChem CID 83272547) has the molecular formula C27H30F3N5O7S and a molecular weight of 625.63 g/mol. Its IUPAC name is 1-tert-butyl-4-methyl-5-(2-morpholin-4-ylsulfonyl-4-nitrophenoxy)-N-[[3-(trifluoromethyl)phenyl]methyl]pyrazole-3-carboxamide.
| Compound Name | 1-tert-butyl-4-methyl-5-(2-morpholin-4-ylsulfonyl-4-nitrophenoxy)-N-[[3-(trifluoromethyl)phenyl]methyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 83272547 |
| Molecular Formula | C27H30F3N5O7S |
| Molecular Weight | 625.63 g/mol |
| Exact Mass | 625.18 |
| IUPAC Name | 1-tert-butyl-4-methyl-5-(2-morpholin-4-ylsulfonyl-4-nitrophenoxy)-N-[[3-(trifluoromethyl)phenyl]methyl]pyrazole-3-carboxamide |
| SMILES | Cc1c(C(=O)NCc2cccc(C(F)(F)F)c2)nn(C(C)(C)C)c1Oc1ccc([N+](=O)[O-])cc1S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C27H30F3N5O7S/c1-17-23(24(36)31-16-18-6-5-7-19(14-18)27(28,29)30)32-34(26(2,3)4)25(17)42-21-9-8-20(35(37)38)15-22(21)43(39,40)33-10-12-41-13-11-33/h5-9,14-15H,10-13,16H2,1-4H3,(H,31,36) |
| InChIKey | RQTGJKIPEDVGPZ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 145.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.63 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|