C29H28F3N5O6S — CID 83272828
4-methyl-1-(4-methylphenyl)-5-[4-nitro-2-(propan-2-ylsulfamoyl)phenoxy]-N-[[3-(trifluoromethyl)phenyl]methyl]pyrazole-3-carboxamide (PubChem CID 83272828) has the molecular formula C29H28F3N5O6S and a molecular weight of 631.63 g/mol. Its IUPAC name is 4-methyl-1-(4-methylphenyl)-5-[4-nitro-2-(propan-2-ylsulfamoyl)phenoxy]-N-[[3-(trifluoromethyl)phenyl]methyl]pyrazole-3-carboxamide.
| Compound Name | 4-methyl-1-(4-methylphenyl)-5-[4-nitro-2-(propan-2-ylsulfamoyl)phenoxy]-N-[[3-(trifluoromethyl)phenyl]methyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 83272828 |
| Molecular Formula | C29H28F3N5O6S |
| Molecular Weight | 631.63 g/mol |
| Exact Mass | 631.17 |
| IUPAC Name | 4-methyl-1-(4-methylphenyl)-5-[4-nitro-2-(propan-2-ylsulfamoyl)phenoxy]-N-[[3-(trifluoromethyl)phenyl]methyl]pyrazole-3-carboxamide |
| SMILES | Cc1ccc(-n2nc(C(=O)NCc3cccc(C(F)(F)F)c3)c(C)c2Oc2ccc([N+](=O)[O-])cc2S(=O)(=O)NC(C)C)cc1 |
| InChI | InChI=1S/C29H28F3N5O6S/c1-17(2)35-44(41,42)25-15-23(37(39)40)12-13-24(25)43-28-19(4)26(34-36(28)22-10-8-18(3)9-11-22)27(38)33-16-20-6-5-7-21(14-20)29(30,31)32/h5-15,17,35H,16H2,1-4H3,(H,33,38) |
| InChIKey | BLQINMDZPYITAU-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 145.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.63 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|