C28H30N6O6S — CID 98371113
5-[2-[[(2S)-butan-2-yl]sulfamoyl]-4-nitrophenoxy]-4-methyl-1-(4-methylphenyl)-N-(pyridin-3-ylmethyl)pyrazole-3-carboxamide (PubChem CID 98371113) has the molecular formula C28H30N6O6S and a molecular weight of 578.65 g/mol. Its IUPAC name is 5-[2-[[(2S)-butan-2-yl]sulfamoyl]-4-nitrophenoxy]-4-methyl-1-(4-methylphenyl)-N-(pyridin-3-ylmethyl)pyrazole-3-carboxamide.
| Compound Name | 5-[2-[[(2S)-butan-2-yl]sulfamoyl]-4-nitrophenoxy]-4-methyl-1-(4-methylphenyl)-N-(pyridin-3-ylmethyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 98371113 |
| Molecular Formula | C28H30N6O6S |
| Molecular Weight | 578.65 g/mol |
| Exact Mass | 578.19 |
| IUPAC Name | 5-[2-[[(2S)-butan-2-yl]sulfamoyl]-4-nitrophenoxy]-4-methyl-1-(4-methylphenyl)-N-(pyridin-3-ylmethyl)pyrazole-3-carboxamide |
| SMILES | CC[C@H](C)NS(=O)(=O)c1cc([N+](=O)[O-])ccc1Oc1c(C)c(C(=O)NCc2cccnc2)nn1-c1ccc(C)cc1 |
| InChI | InChI=1S/C28H30N6O6S/c1-5-19(3)32-41(38,39)25-15-23(34(36)37)12-13-24(25)40-28-20(4)26(27(35)30-17-21-7-6-14-29-16-21)31-33(28)22-10-8-18(2)9-11-22/h6-16,19,32H,5,17H2,1-4H3,(H,30,35)/t19-/m0/s1 |
| InChIKey | DPHAEEZGJHUQGL-IBGZPJMESA-N |
| XLogP | 4.59 |
| TPSA | 158.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.65 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|