C24H28FN5O6S — CID 98441950
5-[2-[[(2R)-butan-2-yl]sulfamoyl]-4-nitrophenoxy]-1-(3-fluorophenyl)-4-methyl-N-propylpyrazole-3-carboxamide (PubChem CID 98441950) has the molecular formula C24H28FN5O6S and a molecular weight of 533.58 g/mol. Its IUPAC name is 5-[2-[[(2R)-butan-2-yl]sulfamoyl]-4-nitrophenoxy]-1-(3-fluorophenyl)-4-methyl-N-propylpyrazole-3-carboxamide.
| Compound Name | 5-[2-[[(2R)-butan-2-yl]sulfamoyl]-4-nitrophenoxy]-1-(3-fluorophenyl)-4-methyl-N-propylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 98441950 |
| Molecular Formula | C24H28FN5O6S |
| Molecular Weight | 533.58 g/mol |
| Exact Mass | 533.17 |
| IUPAC Name | 5-[2-[[(2R)-butan-2-yl]sulfamoyl]-4-nitrophenoxy]-1-(3-fluorophenyl)-4-methyl-N-propylpyrazole-3-carboxamide |
| SMILES | CCCNC(=O)c1nn(-c2cccc(F)c2)c(Oc2ccc([N+](=O)[O-])cc2S(=O)(=O)N[C@H](C)CC)c1C |
| InChI | InChI=1S/C24H28FN5O6S/c1-5-12-26-23(31)22-16(4)24(29(27-22)18-9-7-8-17(25)13-18)36-20-11-10-19(30(32)33)14-21(20)37(34,35)28-15(3)6-2/h7-11,13-15,28H,5-6,12H2,1-4H3,(H,26,31)/t15-/m1/s1 |
| InChIKey | YMEZZDDNSMOULD-OAHLLOKOSA-N |
| XLogP | 4.24 |
| TPSA | 145.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.58 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|