C26H33N5O7S — CID 98414987
5-[2-[[(2S)-butan-2-yl]sulfamoyl]-4-nitrophenoxy]-1-(2,3-dimethylphenyl)-N-(2-methoxyethyl)-4-methylpyrazole-3-carboxamide (PubChem CID 98414987) has the molecular formula C26H33N5O7S and a molecular weight of 559.65 g/mol. Its IUPAC name is 5-[2-[[(2S)-butan-2-yl]sulfamoyl]-4-nitrophenoxy]-1-(2,3-dimethylphenyl)-N-(2-methoxyethyl)-4-methylpyrazole-3-carboxamide.
| Compound Name | 5-[2-[[(2S)-butan-2-yl]sulfamoyl]-4-nitrophenoxy]-1-(2,3-dimethylphenyl)-N-(2-methoxyethyl)-4-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 98414987 |
| Molecular Formula | C26H33N5O7S |
| Molecular Weight | 559.65 g/mol |
| Exact Mass | 559.21 |
| IUPAC Name | 5-[2-[[(2S)-butan-2-yl]sulfamoyl]-4-nitrophenoxy]-1-(2,3-dimethylphenyl)-N-(2-methoxyethyl)-4-methylpyrazole-3-carboxamide |
| SMILES | CC[C@H](C)NS(=O)(=O)c1cc([N+](=O)[O-])ccc1Oc1c(C)c(C(=O)NCCOC)nn1-c1cccc(C)c1C |
| InChI | InChI=1S/C26H33N5O7S/c1-7-17(3)29-39(35,36)23-15-20(31(33)34)11-12-22(23)38-26-19(5)24(25(32)27-13-14-37-6)28-30(26)21-10-8-9-16(2)18(21)4/h8-12,15,17,29H,7,13-14H2,1-6H3,(H,27,32)/t17-/m0/s1 |
| InChIKey | IPULQEOPNAYAEX-KRWDZBQOSA-N |
| XLogP | 3.95 |
| TPSA | 154.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.65 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|