C26H33N5O6S — CID 98260646
N-[(2S)-butan-2-yl]-1-(2,3-dimethylphenyl)-4-methyl-5-[4-nitro-2-(propan-2-ylsulfamoyl)phenoxy]pyrazole-3-carboxamide (PubChem CID 98260646) has the molecular formula C26H33N5O6S and a molecular weight of 543.65 g/mol. Its IUPAC name is N-[(2S)-butan-2-yl]-1-(2,3-dimethylphenyl)-4-methyl-5-[4-nitro-2-(propan-2-ylsulfamoyl)phenoxy]pyrazole-3-carboxamide.
| Compound Name | N-[(2S)-butan-2-yl]-1-(2,3-dimethylphenyl)-4-methyl-5-[4-nitro-2-(propan-2-ylsulfamoyl)phenoxy]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 98260646 |
| Molecular Formula | C26H33N5O6S |
| Molecular Weight | 543.65 g/mol |
| Exact Mass | 543.22 |
| IUPAC Name | N-[(2S)-butan-2-yl]-1-(2,3-dimethylphenyl)-4-methyl-5-[4-nitro-2-(propan-2-ylsulfamoyl)phenoxy]pyrazole-3-carboxamide |
| SMILES | CC[C@H](C)NC(=O)c1nn(-c2cccc(C)c2C)c(Oc2ccc([N+](=O)[O-])cc2S(=O)(=O)NC(C)C)c1C |
| InChI | InChI=1S/C26H33N5O6S/c1-8-17(5)27-25(32)24-19(7)26(30(28-24)21-11-9-10-16(4)18(21)6)37-22-13-12-20(31(33)34)14-23(22)38(35,36)29-15(2)3/h9-15,17,29H,8H2,1-7H3,(H,27,32)/t17-/m0/s1 |
| InChIKey | XRGWYRAMIZBJGW-KRWDZBQOSA-N |
| XLogP | 4.71 |
| TPSA | 145.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.65 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|