C26H31N5O6S — CID 83280957
N-butan-2-yl-5-[2-(cyclopropylsulfamoyl)-4-nitrophenoxy]-1-(2,5-dimethylphenyl)-4-methylpyrazole-3-carboxamide (PubChem CID 83280957) has the molecular formula C26H31N5O6S and a molecular weight of 541.63 g/mol. Its IUPAC name is N-butan-2-yl-5-[2-(cyclopropylsulfamoyl)-4-nitrophenoxy]-1-(2,5-dimethylphenyl)-4-methylpyrazole-3-carboxamide.
| Compound Name | N-butan-2-yl-5-[2-(cyclopropylsulfamoyl)-4-nitrophenoxy]-1-(2,5-dimethylphenyl)-4-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 83280957 |
| Molecular Formula | C26H31N5O6S |
| Molecular Weight | 541.63 g/mol |
| Exact Mass | 541.20 |
| IUPAC Name | N-butan-2-yl-5-[2-(cyclopropylsulfamoyl)-4-nitrophenoxy]-1-(2,5-dimethylphenyl)-4-methylpyrazole-3-carboxamide |
| SMILES | CCC(C)NC(=O)c1nn(-c2cc(C)ccc2C)c(Oc2ccc([N+](=O)[O-])cc2S(=O)(=O)NC2CC2)c1C |
| InChI | InChI=1S/C26H31N5O6S/c1-6-17(4)27-25(32)24-18(5)26(30(28-24)21-13-15(2)7-8-16(21)3)37-22-12-11-20(31(33)34)14-23(22)38(35,36)29-19-9-10-19/h7-8,11-14,17,19,29H,6,9-10H2,1-5H3,(H,27,32) |
| InChIKey | NCRHYBLFPMQSOX-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 145.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.63 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|