C27H24FN5O6S — CID 83277458
5-[2-(cyclopropylsulfamoyl)-4-nitrophenoxy]-N-(4-fluorophenyl)-4-methyl-1-(4-methylphenyl)pyrazole-3-carboxamide (PubChem CID 83277458) has the molecular formula C27H24FN5O6S and a molecular weight of 565.58 g/mol. Its IUPAC name is 5-[2-(cyclopropylsulfamoyl)-4-nitrophenoxy]-N-(4-fluorophenyl)-4-methyl-1-(4-methylphenyl)pyrazole-3-carboxamide.
| Compound Name | 5-[2-(cyclopropylsulfamoyl)-4-nitrophenoxy]-N-(4-fluorophenyl)-4-methyl-1-(4-methylphenyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 83277458 |
| Molecular Formula | C27H24FN5O6S |
| Molecular Weight | 565.58 g/mol |
| Exact Mass | 565.14 |
| IUPAC Name | 5-[2-(cyclopropylsulfamoyl)-4-nitrophenoxy]-N-(4-fluorophenyl)-4-methyl-1-(4-methylphenyl)pyrazole-3-carboxamide |
| SMILES | Cc1ccc(-n2nc(C(=O)Nc3ccc(F)cc3)c(C)c2Oc2ccc([N+](=O)[O-])cc2S(=O)(=O)NC2CC2)cc1 |
| InChI | InChI=1S/C27H24FN5O6S/c1-16-3-11-21(12-4-16)32-27(17(2)25(30-32)26(34)29-19-7-5-18(28)6-8-19)39-23-14-13-22(33(35)36)15-24(23)40(37,38)31-20-9-10-20/h3-8,11-15,20,31H,9-10H2,1-2H3,(H,29,34) |
| InChIKey | NRMADQFFFGHMDA-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 145.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.58 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|