C27H26FN5O8S — CID 83276736
N-(4-fluorophenyl)-5-[2-(2-methoxyethylsulfamoyl)-4-nitrophenoxy]-1-(4-methoxyphenyl)-4-methylpyrazole-3-carboxamide (PubChem CID 83276736) has the molecular formula C27H26FN5O8S and a molecular weight of 599.60 g/mol. Its IUPAC name is N-(4-fluorophenyl)-5-[2-(2-methoxyethylsulfamoyl)-4-nitrophenoxy]-1-(4-methoxyphenyl)-4-methylpyrazole-3-carboxamide.
| Compound Name | N-(4-fluorophenyl)-5-[2-(2-methoxyethylsulfamoyl)-4-nitrophenoxy]-1-(4-methoxyphenyl)-4-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 83276736 |
| Molecular Formula | C27H26FN5O8S |
| Molecular Weight | 599.60 g/mol |
| Exact Mass | 599.15 |
| IUPAC Name | N-(4-fluorophenyl)-5-[2-(2-methoxyethylsulfamoyl)-4-nitrophenoxy]-1-(4-methoxyphenyl)-4-methylpyrazole-3-carboxamide |
| SMILES | COCCNS(=O)(=O)c1cc([N+](=O)[O-])ccc1Oc1c(C)c(C(=O)Nc2ccc(F)cc2)nn1-c1ccc(OC)cc1 |
| InChI | InChI=1S/C27H26FN5O8S/c1-17-25(26(34)30-19-6-4-18(28)5-7-19)31-32(20-8-11-22(40-3)12-9-20)27(17)41-23-13-10-21(33(35)36)16-24(23)42(37,38)29-14-15-39-2/h4-13,16,29H,14-15H2,1-3H3,(H,30,34) |
| InChIKey | GIZZJFZCUVMBBR-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 163.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.60 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|