C25H31N5O8S — CID 83276504
5-[2-(tert-butylsulfamoyl)-4-nitrophenoxy]-N-(2-methoxyethyl)-1-(4-methoxyphenyl)-4-methylpyrazole-3-carboxamide (PubChem CID 83276504) has the molecular formula C25H31N5O8S and a molecular weight of 561.62 g/mol. Its IUPAC name is 5-[2-(tert-butylsulfamoyl)-4-nitrophenoxy]-N-(2-methoxyethyl)-1-(4-methoxyphenyl)-4-methylpyrazole-3-carboxamide.
| Compound Name | 5-[2-(tert-butylsulfamoyl)-4-nitrophenoxy]-N-(2-methoxyethyl)-1-(4-methoxyphenyl)-4-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 83276504 |
| Molecular Formula | C25H31N5O8S |
| Molecular Weight | 561.62 g/mol |
| Exact Mass | 561.19 |
| IUPAC Name | 5-[2-(tert-butylsulfamoyl)-4-nitrophenoxy]-N-(2-methoxyethyl)-1-(4-methoxyphenyl)-4-methylpyrazole-3-carboxamide |
| SMILES | COCCNC(=O)c1nn(-c2ccc(OC)cc2)c(Oc2ccc([N+](=O)[O-])cc2S(=O)(=O)NC(C)(C)C)c1C |
| InChI | InChI=1S/C25H31N5O8S/c1-16-22(23(31)26-13-14-36-5)27-29(17-7-10-19(37-6)11-8-17)24(16)38-20-12-9-18(30(32)33)15-21(20)39(34,35)28-25(2,3)4/h7-12,15,28H,13-14H2,1-6H3,(H,26,31) |
| InChIKey | SAXCLCDBJVGKDA-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 163.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.62 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|