C18H25N5O7S — CID 83283955
5-[2-(tert-butylsulfamoyl)-4-nitrophenoxy]-N-(2-methoxyethyl)-1-methylpyrazole-3-carboxamide (PubChem CID 83283955) has the molecular formula C18H25N5O7S and a molecular weight of 455.49 g/mol. Its IUPAC name is 5-[2-(tert-butylsulfamoyl)-4-nitrophenoxy]-N-(2-methoxyethyl)-1-methylpyrazole-3-carboxamide.
| Compound Name | 5-[2-(tert-butylsulfamoyl)-4-nitrophenoxy]-N-(2-methoxyethyl)-1-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 83283955 |
| Molecular Formula | C18H25N5O7S |
| Molecular Weight | 455.49 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | 5-[2-(tert-butylsulfamoyl)-4-nitrophenoxy]-N-(2-methoxyethyl)-1-methylpyrazole-3-carboxamide |
| SMILES | COCCNC(=O)c1cc(Oc2ccc([N+](=O)[O-])cc2S(=O)(=O)NC(C)(C)C)n(C)n1 |
| InChI | InChI=1S/C18H25N5O7S/c1-18(2,3)21-31(27,28)15-10-12(23(25)26)6-7-14(15)30-16-11-13(20-22(16)4)17(24)19-8-9-29-5/h6-7,10-11,21H,8-9H2,1-5H3,(H,19,24) |
| InChIKey | NNHVEXGOYQIGPO-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 154.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.49 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|