C19H25N5O7S — CID 97473305
N-[(2R)-butan-2-yl]-2-[1-methyl-3-(morpholine-4-carbonyl)pyrazol-5-yl]oxy-5-nitrobenzenesulfonamide (PubChem CID 97473305) has the molecular formula C19H25N5O7S and a molecular weight of 467.50 g/mol. Its IUPAC name is N-[(2R)-butan-2-yl]-2-[1-methyl-3-(morpholine-4-carbonyl)pyrazol-5-yl]oxy-5-nitrobenzenesulfonamide.
| Compound Name | N-[(2R)-butan-2-yl]-2-[1-methyl-3-(morpholine-4-carbonyl)pyrazol-5-yl]oxy-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 97473305 |
| Molecular Formula | C19H25N5O7S |
| Molecular Weight | 467.50 g/mol |
| Exact Mass | 467.15 |
| IUPAC Name | N-[(2R)-butan-2-yl]-2-[1-methyl-3-(morpholine-4-carbonyl)pyrazol-5-yl]oxy-5-nitrobenzenesulfonamide |
| SMILES | CC[C@@H](C)NS(=O)(=O)c1cc([N+](=O)[O-])ccc1Oc1cc(C(=O)N2CCOCC2)nn1C |
| InChI | InChI=1S/C19H25N5O7S/c1-4-13(2)21-32(28,29)17-11-14(24(26)27)5-6-16(17)31-18-12-15(20-22(18)3)19(25)23-7-9-30-10-8-23/h5-6,11-13,21H,4,7-10H2,1-3H3/t13-/m1/s1 |
| InChIKey | ZRGZMAVQDYLCFB-CYBMUJFWSA-N |
| XLogP | 1.67 |
| TPSA | 145.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.50 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|