C26H31N5O7S — CID 98371110
N-[(2R)-butan-2-yl]-2-[4-methyl-1-(4-methylphenyl)-3-(morpholine-4-carbonyl)pyrazol-5-yl]oxy-5-nitrobenzenesulfonamide (PubChem CID 98371110) has the molecular formula C26H31N5O7S and a molecular weight of 557.63 g/mol. Its IUPAC name is N-[(2R)-butan-2-yl]-2-[4-methyl-1-(4-methylphenyl)-3-(morpholine-4-carbonyl)pyrazol-5-yl]oxy-5-nitrobenzenesulfonamide.
| Compound Name | N-[(2R)-butan-2-yl]-2-[4-methyl-1-(4-methylphenyl)-3-(morpholine-4-carbonyl)pyrazol-5-yl]oxy-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 98371110 |
| Molecular Formula | C26H31N5O7S |
| Molecular Weight | 557.63 g/mol |
| Exact Mass | 557.19 |
| IUPAC Name | N-[(2R)-butan-2-yl]-2-[4-methyl-1-(4-methylphenyl)-3-(morpholine-4-carbonyl)pyrazol-5-yl]oxy-5-nitrobenzenesulfonamide |
| SMILES | CC[C@@H](C)NS(=O)(=O)c1cc([N+](=O)[O-])ccc1Oc1c(C)c(C(=O)N2CCOCC2)nn1-c1ccc(C)cc1 |
| InChI | InChI=1S/C26H31N5O7S/c1-5-18(3)28-39(35,36)23-16-21(31(33)34)10-11-22(23)38-26-19(4)24(25(32)29-12-14-37-15-13-29)27-30(26)20-8-6-17(2)7-9-20/h6-11,16,18,28H,5,12-15H2,1-4H3/t18-/m1/s1 |
| InChIKey | CUOSAABPUWZSRK-GOSISDBHSA-N |
| XLogP | 3.74 |
| TPSA | 145.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.63 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|