C25H26ClN5O8S — CID 83276455
[1-(3-chlorophenyl)-4-methyl-5-(2-morpholin-4-ylsulfonyl-4-nitrophenoxy)pyrazol-3-yl]-morpholin-4-ylmethanone (PubChem CID 83276455) has the molecular formula C25H26ClN5O8S and a molecular weight of 592.03 g/mol. Its IUPAC name is [1-(3-chlorophenyl)-4-methyl-5-(2-morpholin-4-ylsulfonyl-4-nitrophenoxy)pyrazol-3-yl]-morpholin-4-ylmethanone.
| Compound Name | [1-(3-chlorophenyl)-4-methyl-5-(2-morpholin-4-ylsulfonyl-4-nitrophenoxy)pyrazol-3-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 83276455 |
| Molecular Formula | C25H26ClN5O8S |
| Molecular Weight | 592.03 g/mol |
| Exact Mass | 591.12 |
| IUPAC Name | [1-(3-chlorophenyl)-4-methyl-5-(2-morpholin-4-ylsulfonyl-4-nitrophenoxy)pyrazol-3-yl]-morpholin-4-ylmethanone |
| SMILES | Cc1c(C(=O)N2CCOCC2)nn(-c2cccc(Cl)c2)c1Oc1ccc([N+](=O)[O-])cc1S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C25H26ClN5O8S/c1-17-23(24(32)28-7-11-37-12-8-28)27-30(19-4-2-3-18(26)15-19)25(17)39-21-6-5-20(31(33)34)16-22(21)40(35,36)29-9-13-38-14-10-29/h2-6,15-16H,7-14H2,1H3 |
| InChIKey | MIKPKMAHPFBZFC-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 146.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.03 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|