C23H33N5O7S — CID 83286082
N-butan-2-yl-1-tert-butyl-4-methyl-5-(2-morpholin-4-ylsulfonyl-4-nitrophenoxy)pyrazole-3-carboxamide (PubChem CID 83286082) has the molecular formula C23H33N5O7S and a molecular weight of 523.61 g/mol. Its IUPAC name is N-butan-2-yl-1-tert-butyl-4-methyl-5-(2-morpholin-4-ylsulfonyl-4-nitrophenoxy)pyrazole-3-carboxamide.
| Compound Name | N-butan-2-yl-1-tert-butyl-4-methyl-5-(2-morpholin-4-ylsulfonyl-4-nitrophenoxy)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 83286082 |
| Molecular Formula | C23H33N5O7S |
| Molecular Weight | 523.61 g/mol |
| Exact Mass | 523.21 |
| IUPAC Name | N-butan-2-yl-1-tert-butyl-4-methyl-5-(2-morpholin-4-ylsulfonyl-4-nitrophenoxy)pyrazole-3-carboxamide |
| SMILES | CCC(C)NC(=O)c1nn(C(C)(C)C)c(Oc2ccc([N+](=O)[O-])cc2S(=O)(=O)N2CCOCC2)c1C |
| InChI | InChI=1S/C23H33N5O7S/c1-7-15(2)24-21(29)20-16(3)22(27(25-20)23(4,5)6)35-18-9-8-17(28(30)31)14-19(18)36(32,33)26-10-12-34-13-11-26/h8-9,14-15H,7,10-13H2,1-6H3,(H,24,29) |
| InChIKey | AHQITPUJPKBHIX-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 145.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.61 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|