C26H29N5O8S — CID 71959586
4-methyl-5-(2-morpholin-4-ylsulfonyl-4-nitrophenoxy)-N-(oxolan-2-ylmethyl)-1-phenylpyrazole-3-carboxamide (PubChem CID 71959586) has the molecular formula C26H29N5O8S and a molecular weight of 571.61 g/mol. Its IUPAC name is 4-methyl-5-(2-morpholin-4-ylsulfonyl-4-nitrophenoxy)-N-(oxolan-2-ylmethyl)-1-phenylpyrazole-3-carboxamide.
| Compound Name | 4-methyl-5-(2-morpholin-4-ylsulfonyl-4-nitrophenoxy)-N-(oxolan-2-ylmethyl)-1-phenylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 71959586 |
| Molecular Formula | C26H29N5O8S |
| Molecular Weight | 571.61 g/mol |
| Exact Mass | 571.17 |
| IUPAC Name | 4-methyl-5-(2-morpholin-4-ylsulfonyl-4-nitrophenoxy)-N-(oxolan-2-ylmethyl)-1-phenylpyrazole-3-carboxamide |
| SMILES | Cc1c(C(=O)NCC2CCCO2)nn(-c2ccccc2)c1Oc1ccc([N+](=O)[O-])cc1S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C26H29N5O8S/c1-18-24(25(32)27-17-21-8-5-13-38-21)28-30(19-6-3-2-4-7-19)26(18)39-22-10-9-20(31(33)34)16-23(22)40(35,36)29-11-14-37-15-12-29/h2-4,6-7,9-10,16,21H,5,8,11-15,17H2,1H3,(H,27,32) |
| InChIKey | OHIILXHCXHWXAP-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 155.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.61 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|