C24H35N5O7S — CID 71958957
1-tert-butyl-5-[2-(tert-butylsulfamoyl)-4-nitrophenoxy]-4-methyl-N-(oxolan-2-ylmethyl)pyrazole-3-carboxamide (PubChem CID 71958957) has the molecular formula C24H35N5O7S and a molecular weight of 537.64 g/mol. Its IUPAC name is 1-tert-butyl-5-[2-(tert-butylsulfamoyl)-4-nitrophenoxy]-4-methyl-N-(oxolan-2-ylmethyl)pyrazole-3-carboxamide.
| Compound Name | 1-tert-butyl-5-[2-(tert-butylsulfamoyl)-4-nitrophenoxy]-4-methyl-N-(oxolan-2-ylmethyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 71958957 |
| Molecular Formula | C24H35N5O7S |
| Molecular Weight | 537.64 g/mol |
| Exact Mass | 537.23 |
| IUPAC Name | 1-tert-butyl-5-[2-(tert-butylsulfamoyl)-4-nitrophenoxy]-4-methyl-N-(oxolan-2-ylmethyl)pyrazole-3-carboxamide |
| SMILES | Cc1c(C(=O)NCC2CCCO2)nn(C(C)(C)C)c1Oc1ccc([N+](=O)[O-])cc1S(=O)(=O)NC(C)(C)C |
| InChI | InChI=1S/C24H35N5O7S/c1-15-20(21(30)25-14-17-9-8-12-35-17)26-28(24(5,6)7)22(15)36-18-11-10-16(29(31)32)13-19(18)37(33,34)27-23(2,3)4/h10-11,13,17,27H,8-9,12,14H2,1-7H3,(H,25,30) |
| InChIKey | KNVQUROJPHARFL-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 154.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.64 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|