C24H35N5O7S — CID 98441133
5-[2-[[(2S)-butan-2-yl]sulfamoyl]-4-nitrophenoxy]-1-tert-butyl-4-methyl-N-[[(2R)-oxolan-2-yl]methyl]pyrazole-3-carboxamide (PubChem CID 98441133) has the molecular formula C24H35N5O7S and a molecular weight of 537.64 g/mol. Its IUPAC name is 5-[2-[[(2S)-butan-2-yl]sulfamoyl]-4-nitrophenoxy]-1-tert-butyl-4-methyl-N-[[(2R)-oxolan-2-yl]methyl]pyrazole-3-carboxamide.
| Compound Name | 5-[2-[[(2S)-butan-2-yl]sulfamoyl]-4-nitrophenoxy]-1-tert-butyl-4-methyl-N-[[(2R)-oxolan-2-yl]methyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 98441133 |
| Molecular Formula | C24H35N5O7S |
| Molecular Weight | 537.64 g/mol |
| Exact Mass | 537.23 |
| IUPAC Name | 5-[2-[[(2S)-butan-2-yl]sulfamoyl]-4-nitrophenoxy]-1-tert-butyl-4-methyl-N-[[(2R)-oxolan-2-yl]methyl]pyrazole-3-carboxamide |
| SMILES | CC[C@H](C)NS(=O)(=O)c1cc([N+](=O)[O-])ccc1Oc1c(C)c(C(=O)NC[C@H]2CCCO2)nn1C(C)(C)C |
| InChI | InChI=1S/C24H35N5O7S/c1-7-15(2)27-37(33,34)20-13-17(29(31)32)10-11-19(20)36-23-16(3)21(26-28(23)24(4,5)6)22(30)25-14-18-9-8-12-35-18/h10-11,13,15,18,27H,7-9,12,14H2,1-6H3,(H,25,30)/t15-,18+/m0/s1 |
| InChIKey | JKRWCXAKXYIJQB-MAUKXSAKSA-N |
| XLogP | 3.63 |
| TPSA | 154.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.64 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|