C22H33N5O6S — CID 71958983
1-tert-butyl-5-[2-(tert-butylsulfamoyl)-4-nitrophenoxy]-4-methyl-N-propan-2-ylpyrazole-3-carboxamide (PubChem CID 71958983) has the molecular formula C22H33N5O6S and a molecular weight of 495.60 g/mol. Its IUPAC name is 1-tert-butyl-5-[2-(tert-butylsulfamoyl)-4-nitrophenoxy]-4-methyl-N-propan-2-ylpyrazole-3-carboxamide.
| Compound Name | 1-tert-butyl-5-[2-(tert-butylsulfamoyl)-4-nitrophenoxy]-4-methyl-N-propan-2-ylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 71958983 |
| Molecular Formula | C22H33N5O6S |
| Molecular Weight | 495.60 g/mol |
| Exact Mass | 495.22 |
| IUPAC Name | 1-tert-butyl-5-[2-(tert-butylsulfamoyl)-4-nitrophenoxy]-4-methyl-N-propan-2-ylpyrazole-3-carboxamide |
| SMILES | Cc1c(C(=O)NC(C)C)nn(C(C)(C)C)c1Oc1ccc([N+](=O)[O-])cc1S(=O)(=O)NC(C)(C)C |
| InChI | InChI=1S/C22H33N5O6S/c1-13(2)23-19(28)18-14(3)20(26(24-18)22(7,8)9)33-16-11-10-15(27(29)30)12-17(16)34(31,32)25-21(4,5)6/h10-13,25H,1-9H3,(H,23,28) |
| InChIKey | WVODEBLOPYSXIL-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 145.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.60 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|