C19H27N5O6S — CID 83285937
1-tert-butyl-4-methyl-5-[2-(2-methylpropylsulfamoyl)-4-nitrophenoxy]pyrazole-3-carboxamide (PubChem CID 83285937) has the molecular formula C19H27N5O6S and a molecular weight of 453.52 g/mol. Its IUPAC name is 1-tert-butyl-4-methyl-5-[2-(2-methylpropylsulfamoyl)-4-nitrophenoxy]pyrazole-3-carboxamide.
| Compound Name | 1-tert-butyl-4-methyl-5-[2-(2-methylpropylsulfamoyl)-4-nitrophenoxy]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 83285937 |
| Molecular Formula | C19H27N5O6S |
| Molecular Weight | 453.52 g/mol |
| Exact Mass | 453.17 |
| IUPAC Name | 1-tert-butyl-4-methyl-5-[2-(2-methylpropylsulfamoyl)-4-nitrophenoxy]pyrazole-3-carboxamide |
| SMILES | Cc1c(C(N)=O)nn(C(C)(C)C)c1Oc1ccc([N+](=O)[O-])cc1S(=O)(=O)NCC(C)C |
| InChI | InChI=1S/C19H27N5O6S/c1-11(2)10-21-31(28,29)15-9-13(24(26)27)7-8-14(15)30-18-12(3)16(17(20)25)22-23(18)19(4,5)6/h7-9,11,21H,10H2,1-6H3,(H2,20,25) |
| InChIKey | YNMLARUSTXULMX-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 159.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.52 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|