C25H31N5O6S — CID 83286209
4-methyl-N-(2-methylpropyl)-5-[2-(2-methylpropylsulfamoyl)-4-nitrophenoxy]-1-phenylpyrazole-3-carboxamide (PubChem CID 83286209) has the molecular formula C25H31N5O6S and a molecular weight of 529.62 g/mol. Its IUPAC name is 4-methyl-N-(2-methylpropyl)-5-[2-(2-methylpropylsulfamoyl)-4-nitrophenoxy]-1-phenylpyrazole-3-carboxamide.
| Compound Name | 4-methyl-N-(2-methylpropyl)-5-[2-(2-methylpropylsulfamoyl)-4-nitrophenoxy]-1-phenylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 83286209 |
| Molecular Formula | C25H31N5O6S |
| Molecular Weight | 529.62 g/mol |
| Exact Mass | 529.20 |
| IUPAC Name | 4-methyl-N-(2-methylpropyl)-5-[2-(2-methylpropylsulfamoyl)-4-nitrophenoxy]-1-phenylpyrazole-3-carboxamide |
| SMILES | Cc1c(C(=O)NCC(C)C)nn(-c2ccccc2)c1Oc1ccc([N+](=O)[O-])cc1S(=O)(=O)NCC(C)C |
| InChI | InChI=1S/C25H31N5O6S/c1-16(2)14-26-24(31)23-18(5)25(29(28-23)19-9-7-6-8-10-19)36-21-12-11-20(30(32)33)13-22(21)37(34,35)27-15-17(3)4/h6-13,16-17,27H,14-15H2,1-5H3,(H,26,31) |
| InChIKey | JGJAPHLKICLUCD-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 145.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.62 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|