C23H27N5O7S — CID 91633546
5-[2-(2-methoxyethylsulfamoyl)-4-nitrophenoxy]-4-methyl-1-phenyl-N-propylpyrazole-3-carboxamide (PubChem CID 91633546) has the molecular formula C23H27N5O7S and a molecular weight of 517.56 g/mol. Its IUPAC name is 5-[2-(2-methoxyethylsulfamoyl)-4-nitrophenoxy]-4-methyl-1-phenyl-N-propylpyrazole-3-carboxamide.
| Compound Name | 5-[2-(2-methoxyethylsulfamoyl)-4-nitrophenoxy]-4-methyl-1-phenyl-N-propylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 91633546 |
| Molecular Formula | C23H27N5O7S |
| Molecular Weight | 517.56 g/mol |
| Exact Mass | 517.16 |
| IUPAC Name | 5-[2-(2-methoxyethylsulfamoyl)-4-nitrophenoxy]-4-methyl-1-phenyl-N-propylpyrazole-3-carboxamide |
| SMILES | CCCNC(=O)c1nn(-c2ccccc2)c(Oc2ccc([N+](=O)[O-])cc2S(=O)(=O)NCCOC)c1C |
| InChI | InChI=1S/C23H27N5O7S/c1-4-12-24-22(29)21-16(2)23(27(26-21)17-8-6-5-7-9-17)35-19-11-10-18(28(30)31)15-20(19)36(32,33)25-13-14-34-3/h5-11,15,25H,4,12-14H2,1-3H3,(H,24,29) |
| InChIKey | QMKGKRLUKJRLSJ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 154.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.56 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|