C26H27N5O9S — CID 83276735
N-(furan-2-ylmethyl)-5-[2-(2-methoxyethylsulfamoyl)-4-nitrophenoxy]-1-(4-methoxyphenyl)-4-methylpyrazole-3-carboxamide (PubChem CID 83276735) has the molecular formula C26H27N5O9S and a molecular weight of 585.60 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-5-[2-(2-methoxyethylsulfamoyl)-4-nitrophenoxy]-1-(4-methoxyphenyl)-4-methylpyrazole-3-carboxamide.
| Compound Name | N-(furan-2-ylmethyl)-5-[2-(2-methoxyethylsulfamoyl)-4-nitrophenoxy]-1-(4-methoxyphenyl)-4-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 83276735 |
| Molecular Formula | C26H27N5O9S |
| Molecular Weight | 585.60 g/mol |
| Exact Mass | 585.15 |
| IUPAC Name | N-(furan-2-ylmethyl)-5-[2-(2-methoxyethylsulfamoyl)-4-nitrophenoxy]-1-(4-methoxyphenyl)-4-methylpyrazole-3-carboxamide |
| SMILES | COCCNS(=O)(=O)c1cc([N+](=O)[O-])ccc1Oc1c(C)c(C(=O)NCc2ccco2)nn1-c1ccc(OC)cc1 |
| InChI | InChI=1S/C26H27N5O9S/c1-17-24(25(32)27-16-21-5-4-13-39-21)29-30(18-6-9-20(38-3)10-7-18)26(17)40-22-11-8-19(31(33)34)15-23(22)41(35,36)28-12-14-37-2/h4-11,13,15,28H,12,14,16H2,1-3H3,(H,27,32) |
| InChIKey | PSPWNTTXXAEVLV-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 177.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.60 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|