C26H27N5O8S — CID 83276648
N-(furan-2-ylmethyl)-1-(4-methoxyphenyl)-4-methyl-5-[4-nitro-2-(propylsulfamoyl)phenoxy]pyrazole-3-carboxamide (PubChem CID 83276648) has the molecular formula C26H27N5O8S and a molecular weight of 569.60 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-1-(4-methoxyphenyl)-4-methyl-5-[4-nitro-2-(propylsulfamoyl)phenoxy]pyrazole-3-carboxamide.
| Compound Name | N-(furan-2-ylmethyl)-1-(4-methoxyphenyl)-4-methyl-5-[4-nitro-2-(propylsulfamoyl)phenoxy]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 83276648 |
| Molecular Formula | C26H27N5O8S |
| Molecular Weight | 569.60 g/mol |
| Exact Mass | 569.16 |
| IUPAC Name | N-(furan-2-ylmethyl)-1-(4-methoxyphenyl)-4-methyl-5-[4-nitro-2-(propylsulfamoyl)phenoxy]pyrazole-3-carboxamide |
| SMILES | CCCNS(=O)(=O)c1cc([N+](=O)[O-])ccc1Oc1c(C)c(C(=O)NCc2ccco2)nn1-c1ccc(OC)cc1 |
| InChI | InChI=1S/C26H27N5O8S/c1-4-13-28-40(35,36)23-15-19(31(33)34)9-12-22(23)39-26-17(2)24(25(32)27-16-21-6-5-14-38-21)29-30(26)18-7-10-20(37-3)11-8-18/h5-12,14-15,28H,4,13,16H2,1-3H3,(H,27,32) |
| InChIKey | KAZPNKDKBYHQIJ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 167.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.60 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|