C24H27N5O6S — CID 83281869
5-[2-(cyclopropylsulfamoyl)-4-nitrophenoxy]-4-methyl-1-(4-methylphenyl)-N-propylpyrazole-3-carboxamide (PubChem CID 83281869) has the molecular formula C24H27N5O6S and a molecular weight of 513.58 g/mol. Its IUPAC name is 5-[2-(cyclopropylsulfamoyl)-4-nitrophenoxy]-4-methyl-1-(4-methylphenyl)-N-propylpyrazole-3-carboxamide.
| Compound Name | 5-[2-(cyclopropylsulfamoyl)-4-nitrophenoxy]-4-methyl-1-(4-methylphenyl)-N-propylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 83281869 |
| Molecular Formula | C24H27N5O6S |
| Molecular Weight | 513.58 g/mol |
| Exact Mass | 513.17 |
| IUPAC Name | 5-[2-(cyclopropylsulfamoyl)-4-nitrophenoxy]-4-methyl-1-(4-methylphenyl)-N-propylpyrazole-3-carboxamide |
| SMILES | CCCNC(=O)c1nn(-c2ccc(C)cc2)c(Oc2ccc([N+](=O)[O-])cc2S(=O)(=O)NC2CC2)c1C |
| InChI | InChI=1S/C24H27N5O6S/c1-4-13-25-23(30)22-16(3)24(28(26-22)18-9-5-15(2)6-10-18)35-20-12-11-19(29(31)32)14-21(20)36(33,34)27-17-7-8-17/h5-6,9-12,14,17,27H,4,7-8,13H2,1-3H3,(H,25,30) |
| InChIKey | KJZSPFONDXQZTE-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 145.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.58 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|