C21H29N5O6S — CID 83285887
1-tert-butyl-N-cyclopropyl-4-methyl-5-[4-nitro-2-(propylsulfamoyl)phenoxy]pyrazole-3-carboxamide (PubChem CID 83285887) has the molecular formula C21H29N5O6S and a molecular weight of 479.56 g/mol. Its IUPAC name is 1-tert-butyl-N-cyclopropyl-4-methyl-5-[4-nitro-2-(propylsulfamoyl)phenoxy]pyrazole-3-carboxamide.
| Compound Name | 1-tert-butyl-N-cyclopropyl-4-methyl-5-[4-nitro-2-(propylsulfamoyl)phenoxy]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 83285887 |
| Molecular Formula | C21H29N5O6S |
| Molecular Weight | 479.56 g/mol |
| Exact Mass | 479.18 |
| IUPAC Name | 1-tert-butyl-N-cyclopropyl-4-methyl-5-[4-nitro-2-(propylsulfamoyl)phenoxy]pyrazole-3-carboxamide |
| SMILES | CCCNS(=O)(=O)c1cc([N+](=O)[O-])ccc1Oc1c(C)c(C(=O)NC2CC2)nn1C(C)(C)C |
| InChI | InChI=1S/C21H29N5O6S/c1-6-11-22-33(30,31)17-12-15(26(28)29)9-10-16(17)32-20-13(2)18(19(27)23-14-7-8-14)24-25(20)21(3,4)5/h9-10,12,14,22H,6-8,11H2,1-5H3,(H,23,27) |
| InChIKey | KLACMBONUQFTJY-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 145.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.56 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|