C23H35N5O6S — CID 97473380
5-[2-[[(2S)-butan-2-yl]sulfamoyl]-4-nitrophenoxy]-1-tert-butyl-4-methyl-N-(2-methylpropyl)pyrazole-3-carboxamide (PubChem CID 97473380) has the molecular formula C23H35N5O6S and a molecular weight of 509.63 g/mol. Its IUPAC name is 5-[2-[[(2S)-butan-2-yl]sulfamoyl]-4-nitrophenoxy]-1-tert-butyl-4-methyl-N-(2-methylpropyl)pyrazole-3-carboxamide.
| Compound Name | 5-[2-[[(2S)-butan-2-yl]sulfamoyl]-4-nitrophenoxy]-1-tert-butyl-4-methyl-N-(2-methylpropyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 97473380 |
| Molecular Formula | C23H35N5O6S |
| Molecular Weight | 509.63 g/mol |
| Exact Mass | 509.23 |
| IUPAC Name | 5-[2-[[(2S)-butan-2-yl]sulfamoyl]-4-nitrophenoxy]-1-tert-butyl-4-methyl-N-(2-methylpropyl)pyrazole-3-carboxamide |
| SMILES | CC[C@H](C)NS(=O)(=O)c1cc([N+](=O)[O-])ccc1Oc1c(C)c(C(=O)NCC(C)C)nn1C(C)(C)C |
| InChI | InChI=1S/C23H35N5O6S/c1-9-15(4)26-35(32,33)19-12-17(28(30)31)10-11-18(19)34-22-16(5)20(21(29)24-13-14(2)3)25-27(22)23(6,7)8/h10-12,14-15,26H,9,13H2,1-8H3,(H,24,29)/t15-/m0/s1 |
| InChIKey | PSKPIGYPQMRSHK-HNNXBMFYSA-N |
| XLogP | 4.11 |
| TPSA | 145.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.63 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|