C26H24N6O6S — CID 83276602
5-[2-(cyclopropylsulfamoyl)-4-nitrophenoxy]-4-methyl-1-phenyl-N-(pyridin-3-ylmethyl)pyrazole-3-carboxamide (PubChem CID 83276602) has the molecular formula C26H24N6O6S and a molecular weight of 548.58 g/mol. Its IUPAC name is 5-[2-(cyclopropylsulfamoyl)-4-nitrophenoxy]-4-methyl-1-phenyl-N-(pyridin-3-ylmethyl)pyrazole-3-carboxamide.
| Compound Name | 5-[2-(cyclopropylsulfamoyl)-4-nitrophenoxy]-4-methyl-1-phenyl-N-(pyridin-3-ylmethyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 83276602 |
| Molecular Formula | C26H24N6O6S |
| Molecular Weight | 548.58 g/mol |
| Exact Mass | 548.15 |
| IUPAC Name | 5-[2-(cyclopropylsulfamoyl)-4-nitrophenoxy]-4-methyl-1-phenyl-N-(pyridin-3-ylmethyl)pyrazole-3-carboxamide |
| SMILES | Cc1c(C(=O)NCc2cccnc2)nn(-c2ccccc2)c1Oc1ccc([N+](=O)[O-])cc1S(=O)(=O)NC1CC1 |
| InChI | InChI=1S/C26H24N6O6S/c1-17-24(25(33)28-16-18-6-5-13-27-15-18)29-31(20-7-3-2-4-8-20)26(17)38-22-12-11-21(32(34)35)14-23(22)39(36,37)30-19-9-10-19/h2-8,11-15,19,30H,9-10,16H2,1H3,(H,28,33) |
| InChIKey | URICUSIRMKZDDV-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 158.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.58 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|