C27H28N6O6S — CID 83276580
5-[2-(butan-2-ylsulfamoyl)-4-nitrophenoxy]-4-methyl-1-phenyl-N-(pyridin-3-ylmethyl)pyrazole-3-carboxamide (PubChem CID 83276580) has the molecular formula C27H28N6O6S and a molecular weight of 564.62 g/mol. Its IUPAC name is 5-[2-(butan-2-ylsulfamoyl)-4-nitrophenoxy]-4-methyl-1-phenyl-N-(pyridin-3-ylmethyl)pyrazole-3-carboxamide.
| Compound Name | 5-[2-(butan-2-ylsulfamoyl)-4-nitrophenoxy]-4-methyl-1-phenyl-N-(pyridin-3-ylmethyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 83276580 |
| Molecular Formula | C27H28N6O6S |
| Molecular Weight | 564.62 g/mol |
| Exact Mass | 564.18 |
| IUPAC Name | 5-[2-(butan-2-ylsulfamoyl)-4-nitrophenoxy]-4-methyl-1-phenyl-N-(pyridin-3-ylmethyl)pyrazole-3-carboxamide |
| SMILES | CCC(C)NS(=O)(=O)c1cc([N+](=O)[O-])ccc1Oc1c(C)c(C(=O)NCc2cccnc2)nn1-c1ccccc1 |
| InChI | InChI=1S/C27H28N6O6S/c1-4-18(2)31-40(37,38)24-15-22(33(35)36)12-13-23(24)39-27-19(3)25(30-32(27)21-10-6-5-7-11-21)26(34)29-17-20-9-8-14-28-16-20/h5-16,18,31H,4,17H2,1-3H3,(H,29,34) |
| InChIKey | KZHGVLXNHOZSCE-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 158.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.62 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|