C22H16F2N4O5 — CID 91634633
5-(2-fluoro-4-nitrophenoxy)-1-(4-fluorophenyl)-N-(furan-2-ylmethyl)-4-methylpyrazole-3-carboxamide (PubChem CID 91634633) has the molecular formula C22H16F2N4O5 and a molecular weight of 454.39 g/mol. Its IUPAC name is 5-(2-fluoro-4-nitrophenoxy)-1-(4-fluorophenyl)-N-(furan-2-ylmethyl)-4-methylpyrazole-3-carboxamide.
| Compound Name | 5-(2-fluoro-4-nitrophenoxy)-1-(4-fluorophenyl)-N-(furan-2-ylmethyl)-4-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 91634633 |
| Molecular Formula | C22H16F2N4O5 |
| Molecular Weight | 454.39 g/mol |
| Exact Mass | 454.11 |
| IUPAC Name | 5-(2-fluoro-4-nitrophenoxy)-1-(4-fluorophenyl)-N-(furan-2-ylmethyl)-4-methylpyrazole-3-carboxamide |
| SMILES | Cc1c(C(=O)NCc2ccco2)nn(-c2ccc(F)cc2)c1Oc1ccc([N+](=O)[O-])cc1F |
| InChI | InChI=1S/C22H16F2N4O5/c1-13-20(21(29)25-12-17-3-2-10-32-17)26-27(15-6-4-14(23)5-7-15)22(13)33-19-9-8-16(28(30)31)11-18(19)24/h2-11H,12H2,1H3,(H,25,29) |
| InChIKey | POUCFGUPVYSJFK-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 112.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.39 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|