C21H19FN4O5 — CID 42812056
[5-(2-fluoro-4-nitrophenoxy)-4-methyl-1-phenylpyrazol-3-yl]-morpholin-4-ylmethanone (PubChem CID 42812056) has the molecular formula C21H19FN4O5 and a molecular weight of 426.40 g/mol. Its IUPAC name is [5-(2-fluoro-4-nitrophenoxy)-4-methyl-1-phenylpyrazol-3-yl]-morpholin-4-ylmethanone.
| Compound Name | [5-(2-fluoro-4-nitrophenoxy)-4-methyl-1-phenylpyrazol-3-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 42812056 |
| Molecular Formula | C21H19FN4O5 |
| Molecular Weight | 426.40 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | [5-(2-fluoro-4-nitrophenoxy)-4-methyl-1-phenylpyrazol-3-yl]-morpholin-4-ylmethanone |
| SMILES | Cc1c(C(=O)N2CCOCC2)nn(-c2ccccc2)c1Oc1ccc([N+](=O)[O-])cc1F |
| InChI | InChI=1S/C21H19FN4O5/c1-14-19(20(27)24-9-11-30-12-10-24)23-25(15-5-3-2-4-6-15)21(14)31-18-8-7-16(26(28)29)13-17(18)22/h2-8,13H,9-12H2,1H3 |
| InChIKey | KAOMBOMDLJRSET-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 99.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.40 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|