C27H25F2N5O6S — CID 83276513
5-[2-(tert-butylsulfamoyl)-4-nitrophenoxy]-1-(3-fluorophenyl)-N-(4-fluorophenyl)-4-methylpyrazole-3-carboxamide (PubChem CID 83276513) has the molecular formula C27H25F2N5O6S and a molecular weight of 585.59 g/mol. Its IUPAC name is 5-[2-(tert-butylsulfamoyl)-4-nitrophenoxy]-1-(3-fluorophenyl)-N-(4-fluorophenyl)-4-methylpyrazole-3-carboxamide.
| Compound Name | 5-[2-(tert-butylsulfamoyl)-4-nitrophenoxy]-1-(3-fluorophenyl)-N-(4-fluorophenyl)-4-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 83276513 |
| Molecular Formula | C27H25F2N5O6S |
| Molecular Weight | 585.59 g/mol |
| Exact Mass | 585.15 |
| IUPAC Name | 5-[2-(tert-butylsulfamoyl)-4-nitrophenoxy]-1-(3-fluorophenyl)-N-(4-fluorophenyl)-4-methylpyrazole-3-carboxamide |
| SMILES | Cc1c(C(=O)Nc2ccc(F)cc2)nn(-c2cccc(F)c2)c1Oc1ccc([N+](=O)[O-])cc1S(=O)(=O)NC(C)(C)C |
| InChI | InChI=1S/C27H25F2N5O6S/c1-16-24(25(35)30-19-10-8-17(28)9-11-19)31-33(20-7-5-6-18(29)14-20)26(16)40-22-13-12-21(34(36)37)15-23(22)41(38,39)32-27(2,3)4/h5-15,32H,1-4H3,(H,30,35) |
| InChIKey | RPIYTBYUYXYEER-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 145.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.59 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|