C26H29N5O6S — CID 71959103
N-cyclopropyl-1-(2,5-dimethylphenyl)-4-methyl-5-(4-nitro-2-pyrrolidin-1-ylsulfonylphenoxy)pyrazole-3-carboxamide (PubChem CID 71959103) has the molecular formula C26H29N5O6S and a molecular weight of 539.61 g/mol. Its IUPAC name is N-cyclopropyl-1-(2,5-dimethylphenyl)-4-methyl-5-(4-nitro-2-pyrrolidin-1-ylsulfonylphenoxy)pyrazole-3-carboxamide.
| Compound Name | N-cyclopropyl-1-(2,5-dimethylphenyl)-4-methyl-5-(4-nitro-2-pyrrolidin-1-ylsulfonylphenoxy)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 71959103 |
| Molecular Formula | C26H29N5O6S |
| Molecular Weight | 539.61 g/mol |
| Exact Mass | 539.18 |
| IUPAC Name | N-cyclopropyl-1-(2,5-dimethylphenyl)-4-methyl-5-(4-nitro-2-pyrrolidin-1-ylsulfonylphenoxy)pyrazole-3-carboxamide |
| SMILES | Cc1ccc(C)c(-n2nc(C(=O)NC3CC3)c(C)c2Oc2ccc([N+](=O)[O-])cc2S(=O)(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C26H29N5O6S/c1-16-6-7-17(2)21(14-16)30-26(18(3)24(28-30)25(32)27-19-8-9-19)37-22-11-10-20(31(33)34)15-23(22)38(35,36)29-12-4-5-13-29/h6-7,10-11,14-15,19H,4-5,8-9,12-13H2,1-3H3,(H,27,32) |
| InChIKey | SNFXGZDFVDXUAD-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 136.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.61 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|