About [1-(4-nitrophenyl)-3-propan-2-ylpyrazol-5-yl] 2-methylbenzoate
[1-(4-nitrophenyl)-3-propan-2-ylpyrazol-5-yl] 2-methylbenzoate (PubChem CID 42726828) has the molecular formula C20H19N3O4
and a molecular weight of 365.39 g/mol. Its IUPAC name is [1-(4-nitrophenyl)-3-propan-2-ylpyrazol-5-yl] 2-methylbenzoate.
Molecular Properties
| Compound Name | [1-(4-nitrophenyl)-3-propan-2-ylpyrazol-5-yl] 2-methylbenzoate |
| PubChem CID | 42726828 |
| Molecular Formula | C20H19N3O4 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | [1-(4-nitrophenyl)-3-propan-2-ylpyrazol-5-yl] 2-methylbenzoate |
| SMILES | Cc1ccccc1C(=O)Oc1cc(C(C)C)nn1-c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H19N3O4/c1-13(2)18-12-19(27-20(24)17-7-5-4-6-14(17)3)22(21-18)15-8-10-16(11-9-15)23(25)26/h4-13H,1-3H3 |
| InChIKey | NUZNPOGKRLMBIP-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 87.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [1-(4-nitrophenyl)-3-propan-2-ylpyrazol-5-yl] 2-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(4-nitrophenyl)-3-propan-2-ylpyrazol-5-yl] 2-methylbenzoate?
The IUPAC name of [1-(4-nitrophenyl)-3-propan-2-ylpyrazol-5-yl] 2-methylbenzoate (CID 42726828) is [1-(4-nitrophenyl)-3-propan-2-ylpyrazol-5-yl] 2-methylbenzoate.
What is the SMILES notation for [1-(4-nitrophenyl)-3-propan-2-ylpyrazol-5-yl] 2-methylbenzoate?
The canonical SMILES for [1-(4-nitrophenyl)-3-propan-2-ylpyrazol-5-yl] 2-methylbenzoate is Cc1ccccc1C(=O)Oc1cc(C(C)C)nn1-c1ccc([N+](=O)[O-])cc1.
What is the InChIKey of [1-(4-nitrophenyl)-3-propan-2-ylpyrazol-5-yl] 2-methylbenzoate?
The InChIKey is NUZNPOGKRLMBIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19N3O4/c1-13(2)18-12-19(27-20(24)17-7-5-4-6-14(17)3)22(21-18)15-8-10-16(11-9-15)23(25)26/h4-13H,1-3H3.
What are the key properties of [1-(4-nitrophenyl)-3-propan-2-ylpyrazol-5-yl] 2-methylbenzoate?
[1-(4-nitrophenyl)-3-propan-2-ylpyrazol-5-yl] 2-methylbenzoate has a molecular weight of 365.39 g/mol, XLogP of 4.43, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(4-nitrophenyl)-3-propan-2-ylpyrazol-5-yl] 2-methylbenzoate is sourced from PubChem (CID 42726828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).