About (3-tert-butyl-1-phenylpyrazol-5-yl) 2-methylbenzoate
(3-tert-butyl-1-phenylpyrazol-5-yl) 2-methylbenzoate (PubChem CID 42726675) has the molecular formula C21H22N2O2
and a molecular weight of 334.42 g/mol. Its IUPAC name is (3-tert-butyl-1-phenylpyrazol-5-yl) 2-methylbenzoate.
Molecular Properties
| Compound Name | (3-tert-butyl-1-phenylpyrazol-5-yl) 2-methylbenzoate |
| PubChem CID | 42726675 |
| Molecular Formula | C21H22N2O2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | (3-tert-butyl-1-phenylpyrazol-5-yl) 2-methylbenzoate |
| SMILES | Cc1ccccc1C(=O)Oc1cc(C(C)(C)C)nn1-c1ccccc1 |
| InChI | InChI=1S/C21H22N2O2/c1-15-10-8-9-13-17(15)20(24)25-19-14-18(21(2,3)4)22-23(19)16-11-6-5-7-12-16/h5-14H,1-4H3 |
| InChIKey | YUOHHXIZWBITBY-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3-tert-butyl-1-phenylpyrazol-5-yl) 2-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-tert-butyl-1-phenylpyrazol-5-yl) 2-methylbenzoate?
The IUPAC name of (3-tert-butyl-1-phenylpyrazol-5-yl) 2-methylbenzoate (CID 42726675) is (3-tert-butyl-1-phenylpyrazol-5-yl) 2-methylbenzoate.
What is the SMILES notation for (3-tert-butyl-1-phenylpyrazol-5-yl) 2-methylbenzoate?
The canonical SMILES for (3-tert-butyl-1-phenylpyrazol-5-yl) 2-methylbenzoate is Cc1ccccc1C(=O)Oc1cc(C(C)(C)C)nn1-c1ccccc1.
What is the InChIKey of (3-tert-butyl-1-phenylpyrazol-5-yl) 2-methylbenzoate?
The InChIKey is YUOHHXIZWBITBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22N2O2/c1-15-10-8-9-13-17(15)20(24)25-19-14-18(21(2,3)4)22-23(19)16-11-6-5-7-12-16/h5-14H,1-4H3.
What are the key properties of (3-tert-butyl-1-phenylpyrazol-5-yl) 2-methylbenzoate?
(3-tert-butyl-1-phenylpyrazol-5-yl) 2-methylbenzoate has a molecular weight of 334.42 g/mol, XLogP of 4.70, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-tert-butyl-1-phenylpyrazol-5-yl) 2-methylbenzoate is sourced from PubChem (CID 42726675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).