C24H28N2O2 — CID 3359862
[3-tert-butyl-1-(3-methylphenyl)pyrazol-5-yl] 2-phenylbutanoate (PubChem CID 3359862) has the molecular formula C24H28N2O2 and a molecular weight of 376.50 g/mol. Its IUPAC name is [3-tert-butyl-1-(3-methylphenyl)pyrazol-5-yl] 2-phenylbutanoate.
| Compound Name | [3-tert-butyl-1-(3-methylphenyl)pyrazol-5-yl] 2-phenylbutanoate |
|---|---|
| PubChem CID | 3359862 |
| Molecular Formula | C24H28N2O2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | [3-tert-butyl-1-(3-methylphenyl)pyrazol-5-yl] 2-phenylbutanoate |
| SMILES | CCC(C(=O)Oc1cc(C(C)(C)C)nn1-c1cccc(C)c1)c1ccccc1 |
| InChI | InChI=1S/C24H28N2O2/c1-6-20(18-12-8-7-9-13-18)23(27)28-22-16-21(24(3,4)5)25-26(22)19-14-10-11-17(2)15-19/h7-16,20H,6H2,1-5H3 |
| InChIKey | OMZFTGPTXFMIHZ-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |