C23H25N3O3 — CID 7793614
[2-[(3-tert-butyl-1-phenylpyrazol-5-yl)amino]-2-oxoethyl] 3-methylbenzoate (PubChem CID 7793614) has the molecular formula C23H25N3O3 and a molecular weight of 391.47 g/mol. Its IUPAC name is [2-[(3-tert-butyl-1-phenylpyrazol-5-yl)amino]-2-oxoethyl] 3-methylbenzoate.
| Compound Name | [2-[(3-tert-butyl-1-phenylpyrazol-5-yl)amino]-2-oxoethyl] 3-methylbenzoate |
|---|---|
| PubChem CID | 7793614 |
| Molecular Formula | C23H25N3O3 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | [2-[(3-tert-butyl-1-phenylpyrazol-5-yl)amino]-2-oxoethyl] 3-methylbenzoate |
| SMILES | Cc1cccc(C(=O)OCC(=O)Nc2cc(C(C)(C)C)nn2-c2ccccc2)c1 |
| InChI | InChI=1S/C23H25N3O3/c1-16-9-8-10-17(13-16)22(28)29-15-21(27)24-20-14-19(23(2,3)4)25-26(20)18-11-6-5-7-12-18/h5-14H,15H2,1-4H3,(H,24,27) |
| InChIKey | XVDKTXSOKOIZFT-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |