C22H22FN3O3 — CID 4855757
[2-[(3-tert-butyl-1-phenylpyrazol-5-yl)amino]-2-oxoethyl] 3-fluorobenzoate (PubChem CID 4855757) has the molecular formula C22H22FN3O3 and a molecular weight of 395.43 g/mol. Its IUPAC name is [2-[(3-tert-butyl-1-phenylpyrazol-5-yl)amino]-2-oxoethyl] 3-fluorobenzoate.
| Compound Name | [2-[(3-tert-butyl-1-phenylpyrazol-5-yl)amino]-2-oxoethyl] 3-fluorobenzoate |
|---|---|
| PubChem CID | 4855757 |
| Molecular Formula | C22H22FN3O3 |
| Molecular Weight | 395.43 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | [2-[(3-tert-butyl-1-phenylpyrazol-5-yl)amino]-2-oxoethyl] 3-fluorobenzoate |
| SMILES | CC(C)(C)c1cc(NC(=O)COC(=O)c2cccc(F)c2)n(-c2ccccc2)n1 |
| InChI | InChI=1S/C22H22FN3O3/c1-22(2,3)18-13-19(26(25-18)17-10-5-4-6-11-17)24-20(27)14-29-21(28)15-8-7-9-16(23)12-15/h4-13H,14H2,1-3H3,(H,24,27) |
| InChIKey | VCBRSWDTALTWDF-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.43 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |