C22H29N3O3 — CID 7722369
[2-[(3-tert-butyl-1-phenylpyrazol-5-yl)amino]-2-oxoethyl] 2-cyclopentylacetate (PubChem CID 7722369) has the molecular formula C22H29N3O3 and a molecular weight of 383.49 g/mol. Its IUPAC name is [2-[(3-tert-butyl-1-phenylpyrazol-5-yl)amino]-2-oxoethyl] 2-cyclopentylacetate.
| Compound Name | [2-[(3-tert-butyl-1-phenylpyrazol-5-yl)amino]-2-oxoethyl] 2-cyclopentylacetate |
|---|---|
| PubChem CID | 7722369 |
| Molecular Formula | C22H29N3O3 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | [2-[(3-tert-butyl-1-phenylpyrazol-5-yl)amino]-2-oxoethyl] 2-cyclopentylacetate |
| SMILES | CC(C)(C)c1cc(NC(=O)COC(=O)CC2CCCC2)n(-c2ccccc2)n1 |
| InChI | InChI=1S/C22H29N3O3/c1-22(2,3)18-14-19(25(24-18)17-11-5-4-6-12-17)23-20(26)15-28-21(27)13-16-9-7-8-10-16/h4-6,11-12,14,16H,7-10,13,15H2,1-3H3,(H,23,26) |
| InChIKey | LQIQNWZEPFIVRJ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |