C33H33N3O6 — CID 16663730
[4,6-bis[[(2R)-2-phenylbutanoyl]oxy]-1,3,5-triazin-2-yl] (2R)-2-phenylbutanoate (PubChem CID 16663730) has the molecular formula C33H33N3O6 and a molecular weight of 567.64 g/mol. Its IUPAC name is [4,6-bis[[(2R)-2-phenylbutanoyl]oxy]-1,3,5-triazin-2-yl] (2R)-2-phenylbutanoate.
| Compound Name | [4,6-bis[[(2R)-2-phenylbutanoyl]oxy]-1,3,5-triazin-2-yl] (2R)-2-phenylbutanoate |
|---|---|
| PubChem CID | 16663730 |
| Molecular Formula | C33H33N3O6 |
| Molecular Weight | 567.64 g/mol |
| Exact Mass | 567.24 |
| IUPAC Name | [4,6-bis[[(2R)-2-phenylbutanoyl]oxy]-1,3,5-triazin-2-yl] (2R)-2-phenylbutanoate |
| SMILES | CC[C@@H](C(=O)Oc1nc(OC(=O)[C@H](CC)c2ccccc2)nc(OC(=O)[C@H](CC)c2ccccc2)n1)c1ccccc1 |
| InChI | InChI=1S/C33H33N3O6/c1-4-25(22-16-10-7-11-17-22)28(37)40-31-34-32(41-29(38)26(5-2)23-18-12-8-13-19-23)36-33(35-31)42-30(39)27(6-3)24-20-14-9-15-21-24/h7-21,25-27H,4-6H2,1-3H3/t25-,26-,27-/m1/s1 |
| InChIKey | VPVDZGAKPRTECY-ZONZVBGPSA-N |
| XLogP | 6.17 |
| TPSA | 117.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.64 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |