About (phenylcarbamoylamino) 2-phenylbutanoate
(phenylcarbamoylamino) 2-phenylbutanoate (PubChem CID 87787632) has the molecular formula C17H18N2O3
and a molecular weight of 298.34 g/mol. Its IUPAC name is (phenylcarbamoylamino) 2-phenylbutanoate.
Molecular Properties
| Compound Name | (phenylcarbamoylamino) 2-phenylbutanoate |
| PubChem CID | 87787632 |
| Molecular Formula | C17H18N2O3 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | (phenylcarbamoylamino) 2-phenylbutanoate |
| SMILES | CCC(C(=O)ONC(=O)Nc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H18N2O3/c1-2-15(13-9-5-3-6-10-13)16(20)22-19-17(21)18-14-11-7-4-8-12-14/h3-12,15H,2H2,1H3,(H2,18,19,21) |
| InChIKey | JRHKKBITAUQLET-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (phenylcarbamoylamino) 2-phenylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (phenylcarbamoylamino) 2-phenylbutanoate?
The IUPAC name of (phenylcarbamoylamino) 2-phenylbutanoate (CID 87787632) is (phenylcarbamoylamino) 2-phenylbutanoate.
What is the SMILES notation for (phenylcarbamoylamino) 2-phenylbutanoate?
The canonical SMILES for (phenylcarbamoylamino) 2-phenylbutanoate is CCC(C(=O)ONC(=O)Nc1ccccc1)c1ccccc1.
What is the InChIKey of (phenylcarbamoylamino) 2-phenylbutanoate?
The InChIKey is JRHKKBITAUQLET-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18N2O3/c1-2-15(13-9-5-3-6-10-13)16(20)22-19-17(21)18-14-11-7-4-8-12-14/h3-12,15H,2H2,1H3,(H2,18,19,21).
What are the key properties of (phenylcarbamoylamino) 2-phenylbutanoate?
(phenylcarbamoylamino) 2-phenylbutanoate has a molecular weight of 298.34 g/mol, XLogP of 3.46, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (phenylcarbamoylamino) 2-phenylbutanoate is sourced from PubChem (CID 87787632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).