C20H27FN2O2 — CID 5034269
[3-tert-butyl-1-(3-fluorophenyl)pyrazol-5-yl] heptanoate (PubChem CID 5034269) has the molecular formula C20H27FN2O2 and a molecular weight of 346.45 g/mol. Its IUPAC name is [3-tert-butyl-1-(3-fluorophenyl)pyrazol-5-yl] heptanoate.
| Compound Name | [3-tert-butyl-1-(3-fluorophenyl)pyrazol-5-yl] heptanoate |
|---|---|
| PubChem CID | 5034269 |
| Molecular Formula | C20H27FN2O2 |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | [3-tert-butyl-1-(3-fluorophenyl)pyrazol-5-yl] heptanoate |
| SMILES | CCCCCCC(=O)Oc1cc(C(C)(C)C)nn1-c1cccc(F)c1 |
| InChI | InChI=1S/C20H27FN2O2/c1-5-6-7-8-12-19(24)25-18-14-17(20(2,3)4)22-23(18)16-11-9-10-15(21)13-16/h9-11,13-14H,5-8,12H2,1-4H3 |
| InChIKey | VZWIXQVMONKBGM-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|