C16H17Cl3N2O2 — CID 42727401
[3-tert-butyl-1-(3,4-dichlorophenyl)pyrazol-5-yl] 3-chloropropanoate (PubChem CID 42727401) has the molecular formula C16H17Cl3N2O2 and a molecular weight of 375.68 g/mol. Its IUPAC name is [3-tert-butyl-1-(3,4-dichlorophenyl)pyrazol-5-yl] 3-chloropropanoate.
| Compound Name | [3-tert-butyl-1-(3,4-dichlorophenyl)pyrazol-5-yl] 3-chloropropanoate |
|---|---|
| PubChem CID | 42727401 |
| Molecular Formula | C16H17Cl3N2O2 |
| Molecular Weight | 375.68 g/mol |
| Exact Mass | 374.04 |
| IUPAC Name | [3-tert-butyl-1-(3,4-dichlorophenyl)pyrazol-5-yl] 3-chloropropanoate |
| SMILES | CC(C)(C)c1cc(OC(=O)CCCl)n(-c2ccc(Cl)c(Cl)c2)n1 |
| InChI | InChI=1S/C16H17Cl3N2O2/c1-16(2,3)13-9-14(23-15(22)6-7-17)21(20-13)10-4-5-11(18)12(19)8-10/h4-5,8-9H,6-7H2,1-3H3 |
| InChIKey | XSDUGTARBXTULX-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.68 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|