C19H16Cl2N2O2 — CID 1061693
[1-(3,4-dichlorophenyl)-3-propan-2-ylpyrazol-5-yl] benzoate (PubChem CID 1061693) has the molecular formula C19H16Cl2N2O2 and a molecular weight of 375.26 g/mol. Its IUPAC name is [1-(3,4-dichlorophenyl)-3-propan-2-ylpyrazol-5-yl] benzoate.
| Compound Name | [1-(3,4-dichlorophenyl)-3-propan-2-ylpyrazol-5-yl] benzoate |
|---|---|
| PubChem CID | 1061693 |
| Molecular Formula | C19H16Cl2N2O2 |
| Molecular Weight | 375.26 g/mol |
| Exact Mass | 374.06 |
| IUPAC Name | [1-(3,4-dichlorophenyl)-3-propan-2-ylpyrazol-5-yl] benzoate |
| SMILES | CC(C)c1cc(OC(=O)c2ccccc2)n(-c2ccc(Cl)c(Cl)c2)n1 |
| InChI | InChI=1S/C19H16Cl2N2O2/c1-12(2)17-11-18(25-19(24)13-6-4-3-5-7-13)23(22-17)14-8-9-15(20)16(21)10-14/h3-12H,1-2H3 |
| InChIKey | YSQJWSZLWRQRFJ-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.26 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |